C12H10BrF3O4S — CID 170838189
2-[2-(2-bromopropanoyl)-6-(trifluoromethylsulfanyl)phenyl]-2-hydroxyacetic acid (PubChem CID 170838189) has the molecular formula C12H10BrF3O4S and a molecular weight of 387.17 g/mol. Its IUPAC name is 2-[2-(2-bromopropanoyl)-6-(trifluoromethylsulfanyl)phenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[2-(2-bromopropanoyl)-6-(trifluoromethylsulfanyl)phenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 170838189 |
| Molecular Formula | C12H10BrF3O4S |
| Molecular Weight | 387.17 g/mol |
| Exact Mass | 385.94 |
| IUPAC Name | 2-[2-(2-bromopropanoyl)-6-(trifluoromethylsulfanyl)phenyl]-2-hydroxyacetic acid |
| SMILES | CC(Br)C(=O)c1cccc(SC(F)(F)F)c1C(O)C(=O)O |
| InChI | InChI=1S/C12H10BrF3O4S/c1-5(13)9(17)6-3-2-4-7(21-12(14,15)16)8(6)10(18)11(19)20/h2-5,10,18H,1H3,(H,19,20) |
| InChIKey | XDMBAAAGWRFFFS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.17 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|