C21H25ClN2O2 — CID 170839402
N-(2,4-dimethoxyphenyl)-2-(1,3,3-trimethylindol-2-ylidene)ethanimine;hydrochloride (PubChem CID 170839402) has the molecular formula C21H25ClN2O2 and a molecular weight of 372.90 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-2-(1,3,3-trimethylindol-2-ylidene)ethanimine;hydrochloride.
| Compound Name | N-(2,4-dimethoxyphenyl)-2-(1,3,3-trimethylindol-2-ylidene)ethanimine;hydrochloride |
|---|---|
| PubChem CID | 170839402 |
| Molecular Formula | C21H25ClN2O2 |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-2-(1,3,3-trimethylindol-2-ylidene)ethanimine;hydrochloride |
| SMILES | COc1ccc(/N=C/C=C2N(C)c3ccccc3C2(C)C)c(OC)c1.Cl |
| InChI | InChI=1S/C21H24N2O2.ClH/c1-21(2)16-8-6-7-9-18(16)23(3)20(21)12-13-22-17-11-10-15(24-4)14-19(17)25-5;/h6-14H,1-5H3;1H/b20-12?,22-13+; |
| InChIKey | QAMCXJOYXRSXDU-ZNNGEFPFSA-N |
| XLogP | 5.14 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|