C34H32N12Na2O6S2 — CID 170839770
CID 170839770 (PubChem CID 170839770) has the molecular formula C34H32N12Na2O6S2 and a molecular weight of 814.82 g/mol.
| Compound Name | CID 170839770 |
|---|---|
| PubChem CID | 170839770 |
| Molecular Formula | C34H32N12Na2O6S2 |
| Molecular Weight | 814.82 g/mol |
| Exact Mass | 814.18 |
| IUPAC Name | — |
| SMILES | C/N=c1\[nH]/c(=N/c2ccc(C=Cc3ccc(/N=c4/[nH]/c(=N\C)[nH]/c(=N\c5ccccc5)[nH]4)cc3S(=O)(=O)O)c(S(=O)(=O)O)c2)[nH]/c(=N/c2ccccc2)[nH]1.[Na].[Na] |
| InChI | InChI=1S/C34H32N12O6S2.2Na/c1-35-29-41-31(37-23-9-5-3-6-10-23)45-33(43-29)39-25-17-15-21(27(19-25)53(47,48)49)13-14-22-16-18-26(20-28(22)54(50,51)52)40-34-44-30(36-2)42-32(46-34)38-24-11-7-4-8-12-24;;/h3-20H,1-2H3,(H,47,48,49)(H,50,51,52)(H3,35,37,39,41,43,45)(H3,36,38,40,42,44,46);; |
| InChIKey | STWYQQKTEPIOAV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 277.64 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.82 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|