C10H16N2O2 — CID 17084
N,N-diethyl-3,5-dimethyl-1,2-oxazole-4-carboxamide (PubChem CID 17084) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is N,N-diethyl-3,5-dimethyl-1,2-oxazole-4-carboxamide.
| Compound Name | N,N-diethyl-3,5-dimethyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 17084 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | N,N-diethyl-3,5-dimethyl-1,2-oxazole-4-carboxamide |
| SMILES | CCN(CC)C(=O)c1c(C)noc1C |
| InChI | InChI=1S/C10H16N2O2/c1-5-12(6-2)10(13)9-7(3)11-14-8(9)4/h5-6H2,1-4H3 |
| InChIKey | NFALFEDRJGVKNY-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |