C20H19FN4O6S — CID 17084023
3-(benzenesulfonylmethyl)-N-[2-[[2-(4-fluorophenoxy)acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17084023) has the molecular formula C20H19FN4O6S and a molecular weight of 462.46 g/mol. Its IUPAC name is 3-(benzenesulfonylmethyl)-N-[2-[[2-(4-fluorophenoxy)acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-(benzenesulfonylmethyl)-N-[2-[[2-(4-fluorophenoxy)acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17084023 |
| Molecular Formula | C20H19FN4O6S |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 3-(benzenesulfonylmethyl)-N-[2-[[2-(4-fluorophenoxy)acetyl]amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | O=C(COc1ccc(F)cc1)NCCNC(=O)c1nc(CS(=O)(=O)c2ccccc2)no1 |
| InChI | InChI=1S/C20H19FN4O6S/c21-14-6-8-15(9-7-14)30-12-18(26)22-10-11-23-19(27)20-24-17(25-31-20)13-32(28,29)16-4-2-1-3-5-16/h1-9H,10-13H2,(H,22,26)(H,23,27) |
| InChIKey | PWGMJXVOZCRVOH-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 140.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|