About 2-methyl-5-prop-1-en-2-ylcyclohexan-1-ol;propanoic acid
2-methyl-5-prop-1-en-2-ylcyclohexan-1-ol;propanoic acid (PubChem CID 170840584) has the molecular formula C13H24O3
and a molecular weight of 228.33 g/mol. Its IUPAC name is 2-methyl-5-prop-1-en-2-ylcyclohexan-1-ol;propanoic acid.
Molecular Properties
| Compound Name | 2-methyl-5-prop-1-en-2-ylcyclohexan-1-ol;propanoic acid |
| PubChem CID | 170840584 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 2-methyl-5-prop-1-en-2-ylcyclohexan-1-ol;propanoic acid |
| SMILES | C=C(C)C1CCC(C)C(O)C1.CCC(=O)O |
| InChI | InChI=1S/C10H18O.C3H6O2/c1-7(2)9-5-4-8(3)10(11)6-9;1-2-3(4)5/h8-11H,1,4-6H2,2-3H3;2H2,1H3,(H,4,5) |
| InChIKey | KGRIJEBSYAPSCY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-5-prop-1-en-2-ylcyclohexan-1-ol;propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-prop-1-en-2-ylcyclohexan-1-ol;propanoic acid?
The IUPAC name of 2-methyl-5-prop-1-en-2-ylcyclohexan-1-ol;propanoic acid (CID 170840584) is 2-methyl-5-prop-1-en-2-ylcyclohexan-1-ol;propanoic acid.
What is the SMILES notation for 2-methyl-5-prop-1-en-2-ylcyclohexan-1-ol;propanoic acid?
The canonical SMILES for 2-methyl-5-prop-1-en-2-ylcyclohexan-1-ol;propanoic acid is C=C(C)C1CCC(C)C(O)C1.CCC(=O)O.
What is the InChIKey of 2-methyl-5-prop-1-en-2-ylcyclohexan-1-ol;propanoic acid?
The InChIKey is KGRIJEBSYAPSCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O.C3H6O2/c1-7(2)9-5-4-8(3)10(11)6-9;1-2-3(4)5/h8-11H,1,4-6H2,2-3H3;2H2,1H3,(H,4,5).
What are the key properties of 2-methyl-5-prop-1-en-2-ylcyclohexan-1-ol;propanoic acid?
2-methyl-5-prop-1-en-2-ylcyclohexan-1-ol;propanoic acid has a molecular weight of 228.33 g/mol, XLogP of 2.84, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-prop-1-en-2-ylcyclohexan-1-ol;propanoic acid is sourced from PubChem (CID 170840584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).