About 1,1-dibutoxy-2-methylpentane-2,4-diol;titanium
1,1-dibutoxy-2-methylpentane-2,4-diol;titanium (PubChem CID 170840899) has the molecular formula C14H30O4Ti
and a molecular weight of 310.26 g/mol. Its IUPAC name is 1,1-dibutoxy-2-methylpentane-2,4-diol;titanium.
Molecular Properties
| Compound Name | 1,1-dibutoxy-2-methylpentane-2,4-diol;titanium |
| PubChem CID | 170840899 |
| Molecular Formula | C14H30O4Ti |
| Molecular Weight | 310.26 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 1,1-dibutoxy-2-methylpentane-2,4-diol;titanium |
| SMILES | CCCCOC(OCCCC)C(C)(O)CC(C)O.[Ti] |
| InChI | InChI=1S/C14H30O4.Ti/c1-5-7-9-17-13(18-10-8-6-2)14(4,16)11-12(3)15;/h12-13,15-16H,5-11H2,1-4H3; |
| InChIKey | CPIVZBLWOWYQAV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.26 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dibutoxy-2-methylpentane-2,4-diol;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dibutoxy-2-methylpentane-2,4-diol;titanium?
The IUPAC name of 1,1-dibutoxy-2-methylpentane-2,4-diol;titanium (CID 170840899) is 1,1-dibutoxy-2-methylpentane-2,4-diol;titanium.
What is the SMILES notation for 1,1-dibutoxy-2-methylpentane-2,4-diol;titanium?
The canonical SMILES for 1,1-dibutoxy-2-methylpentane-2,4-diol;titanium is CCCCOC(OCCCC)C(C)(O)CC(C)O.[Ti].
What is the InChIKey of 1,1-dibutoxy-2-methylpentane-2,4-diol;titanium?
The InChIKey is CPIVZBLWOWYQAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30O4.Ti/c1-5-7-9-17-13(18-10-8-6-2)14(4,16)11-12(3)15;/h12-13,15-16H,5-11H2,1-4H3;.
What are the key properties of 1,1-dibutoxy-2-methylpentane-2,4-diol;titanium?
1,1-dibutoxy-2-methylpentane-2,4-diol;titanium has a molecular weight of 310.26 g/mol, XLogP of 2.47, 11 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dibutoxy-2-methylpentane-2,4-diol;titanium is sourced from PubChem (CID 170840899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).