About 2-(2-methoxyethoxy)ethyl 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylate
2-(2-methoxyethoxy)ethyl 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylate (PubChem CID 170841929) has the molecular formula C26H28N2O6S
and a molecular weight of 496.59 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)ethyl 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylate.
Molecular Properties
| Compound Name | 2-(2-methoxyethoxy)ethyl 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylate |
| PubChem CID | 170841929 |
| Molecular Formula | C26H28N2O6S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 2-(2-methoxyethoxy)ethyl 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylate |
| SMILES | CCN(CC)c1ccc2c(C(=O)OCCOCCOC)c(-c3nc4ccccc4s3)c(=O)oc2c1 |
| InChI | InChI=1S/C26H28N2O6S/c1-4-28(5-2)17-10-11-18-20(16-17)34-26(30)23(24-27-19-8-6-7-9-21(19)35-24)22(18)25(29)33-15-14-32-13-12-31-3/h6-11,16H,4-5,12-15H2,1-3H3 |
| InChIKey | XARCTBKSZCJXNO-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 91.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methoxyethoxy)ethyl 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methoxyethoxy)ethyl 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylate?
The IUPAC name of 2-(2-methoxyethoxy)ethyl 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylate (CID 170841929) is 2-(2-methoxyethoxy)ethyl 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylate.
What is the SMILES notation for 2-(2-methoxyethoxy)ethyl 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylate?
The canonical SMILES for 2-(2-methoxyethoxy)ethyl 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylate is CCN(CC)c1ccc2c(C(=O)OCCOCCOC)c(-c3nc4ccccc4s3)c(=O)oc2c1.
What is the InChIKey of 2-(2-methoxyethoxy)ethyl 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylate?
The InChIKey is XARCTBKSZCJXNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H28N2O6S/c1-4-28(5-2)17-10-11-18-20(16-17)34-26(30)23(24-27-19-8-6-7-9-21(19)35-24)22(18)25(29)33-15-14-32-13-12-31-3/h6-11,16H,4-5,12-15H2,1-3H3.
What are the key properties of 2-(2-methoxyethoxy)ethyl 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylate?
2-(2-methoxyethoxy)ethyl 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylate has a molecular weight of 496.59 g/mol, XLogP of 4.74, 11 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methoxyethoxy)ethyl 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylate is sourced from PubChem (CID 170841929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).