C20H30O — CID 170842005
1-[(E)-but-2-enoxy]-4-(4-butylcyclohexyl)benzene (PubChem CID 170842005) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is 1-[(E)-but-2-enoxy]-4-(4-butylcyclohexyl)benzene.
| Compound Name | 1-[(E)-but-2-enoxy]-4-(4-butylcyclohexyl)benzene |
|---|---|
| PubChem CID | 170842005 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | 1-[(E)-but-2-enoxy]-4-(4-butylcyclohexyl)benzene |
| SMILES | C/C=C/COc1ccc(C2CCC(CCCC)CC2)cc1 |
| InChI | InChI=1S/C20H30O/c1-3-5-7-17-8-10-18(11-9-17)19-12-14-20(15-13-19)21-16-6-4-2/h4,6,12-15,17-18H,3,5,7-11,16H2,1-2H3/b6-4+ |
| InChIKey | ZEFMFGDVTUMDHX-GQCTYLIASA-N |
| XLogP | 6.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|