C30H18Cl2N6NiO4 — CID 170842138
3-[(4-chlorophenyl)diazenyl]-4-hydroxy-1H-quinolin-2-one;3-[(4-chlorophenyl)diazenyl]quinoline-2,4-diolate;nickel(2+) (PubChem CID 170842138) has the molecular formula C30H18Cl2N6NiO4 and a molecular weight of 656.11 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)diazenyl]-4-hydroxy-1H-quinolin-2-one;3-[(4-chlorophenyl)diazenyl]quinoline-2,4-diolate;nickel(2+).
| Compound Name | 3-[(4-chlorophenyl)diazenyl]-4-hydroxy-1H-quinolin-2-one;3-[(4-chlorophenyl)diazenyl]quinoline-2,4-diolate;nickel(2+) |
|---|---|
| PubChem CID | 170842138 |
| Molecular Formula | C30H18Cl2N6NiO4 |
| Molecular Weight | 656.11 g/mol |
| Exact Mass | 654.01 |
| IUPAC Name | 3-[(4-chlorophenyl)diazenyl]-4-hydroxy-1H-quinolin-2-one;3-[(4-chlorophenyl)diazenyl]quinoline-2,4-diolate;nickel(2+) |
| SMILES | O=c1[nH]c2ccccc2c(O)c1/N=N/c1ccc(Cl)cc1.[Ni+2].[O-]c1nc2ccccc2c([O-])c1/N=N/c1ccc(Cl)cc1 |
| InChI | InChI=1S/2C15H10ClN3O2.Ni/c2*16-9-5-7-10(8-6-9)18-19-13-14(20)11-3-1-2-4-12(11)17-15(13)21;/h2*1-8H,(H2,17,20,21);/q;;+2/p-2/b2*19-18+; |
| InChIKey | BEGSKDOWMOKGNK-VFUQPONKSA-L |
| XLogP | 7.75 |
| TPSA | 161.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.11 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|