About CID 170842213
CID 170842213 (PubChem CID 170842213) has the molecular formula H5O5PPb3
and a molecular weight of 737.61 g/mol.
Molecular Properties
| Compound Name | CID 170842213 |
| PubChem CID | 170842213 |
| Molecular Formula | H5O5PPb3 |
| Molecular Weight | 737.61 g/mol |
| Exact Mass | 739.92 |
| IUPAC Name | — |
| SMILES | O.O.[O-]P([O-])O.[Pb+2].[Pb].[Pb] |
| InChI | InChI=1S/HO3P.2H2O.3Pb/c1-4(2)3;;;;;/h1H;2*1H2;;;/q-2;;;;;+2 |
| InChIKey | OPMBYDNAOLDPLN-UHFFFAOYSA-N |
| XLogP | -4.87 |
| TPSA | 129.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 737.61 |
| LogP ≤ 5 | -4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 170842213 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 170842213?
The IUPAC name of CID 170842213 (CID 170842213) is not available.
What is the SMILES notation for CID 170842213?
The canonical SMILES for CID 170842213 is O.O.[O-]P([O-])O.[Pb+2].[Pb].[Pb].
What is the InChIKey of CID 170842213?
The InChIKey is OPMBYDNAOLDPLN-UHFFFAOYSA-N. The full InChI is InChI=1S/HO3P.2H2O.3Pb/c1-4(2)3;;;;;/h1H;2*1H2;;;/q-2;;;;;+2.
What are the key properties of CID 170842213?
CID 170842213 has a molecular weight of 737.61 g/mol, XLogP of -4.87, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 170842213 is sourced from PubChem (CID 170842213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).