C41H30ClKN9NaO26S8 — CID 170842443
CID 170842443 (PubChem CID 170842443) has the molecular formula C41H30ClKN9NaO26S8 and a molecular weight of 1418.80 g/mol.
| Compound Name | CID 170842443 |
|---|---|
| PubChem CID | 170842443 |
| Molecular Formula | C41H30ClKN9NaO26S8 |
| Molecular Weight | 1418.80 g/mol |
| Exact Mass | 1416.83 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)OCCS(=O)(=O)c1ccc(/N=N/c2c(S(=O)(=O)O)cc3c(S(=O)(=O)O)ccc(/N=c4\nc(Cl)[nH]/c(=N\c5cc(S(=O)(=O)O)cc6cc(S(=O)(=O)O)c(/N=N/c7ccc8c(S(=O)(=O)O)cccc8c7S(=O)(=O)O)c(O)c56)[nH]4)c3c2O)cc1.[K].[Na] |
| InChI | InChI=1S/C41H30ClN9O26S8.K.Na/c42-39-45-40(43-25-10-11-29(81(62,63)64)24-17-31(83(68,69)70)35(37(53)33(24)25)50-48-19-4-6-20(7-5-19)78(54,55)13-12-77-85(74,75)76)47-41(46-39)44-27-16-21(79(56,57)58)14-18-15-30(82(65,66)67)34(36(52)32(18)27)51-49-26-9-8-22-23(38(26)84(71,72)73)2-1-3-28(22)80(59,60)61;;/h1-11,14-17,52-53H,12-13H2,(H,56,57,58)(H,59,60,61)(H,62,63,64)(H,65,66,67)(H,68,69,70)(H,71,72,73)(H,74,75,76)(H2,43,44,45,46,47);;/b50-48+,51-49+;; |
| InChIKey | KBOXBAKJSIXHMX-BRTKAWSZSA-N |
| XLogP | 3.87 |
| TPSA | 583.05 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 26 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 87 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1418.80 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 26 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|