About CID 170842674
CID 170842674 (PubChem CID 170842674) has the molecular formula C20H4AlBr4Cl4O5
and a molecular weight of 812.66 g/mol.
Molecular Properties
| Compound Name | CID 170842674 |
| PubChem CID | 170842674 |
| Molecular Formula | C20H4AlBr4Cl4O5 |
| Molecular Weight | 812.66 g/mol |
| Exact Mass | 806.54 |
| IUPAC Name | — |
| SMILES | O=C1OC2(c3cc(Br)c(O)c(Br)c3Oc3c2cc(Br)c(O)c3Br)c2c(Cl)c(Cl)c(Cl)c(Cl)c21.[Al] |
| InChI | InChI=1S/C20H4Br4Cl4O5.Al/c21-5-1-3-17(9(23)15(5)29)32-18-4(2-6(22)16(30)10(18)24)20(3)8-7(19(31)33-20)11(25)13(27)14(28)12(8)26;/h1-2,29-30H; |
| InChIKey | QAJDCBZUQINKJI-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 812.66 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze CID 170842674 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 170842674?
The IUPAC name of CID 170842674 (CID 170842674) is not available.
What is the SMILES notation for CID 170842674?
The canonical SMILES for CID 170842674 is O=C1OC2(c3cc(Br)c(O)c(Br)c3Oc3c2cc(Br)c(O)c3Br)c2c(Cl)c(Cl)c(Cl)c(Cl)c21.[Al].
What is the InChIKey of CID 170842674?
The InChIKey is QAJDCBZUQINKJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H4Br4Cl4O5.Al/c21-5-1-3-17(9(23)15(5)29)32-18-4(2-6(22)16(30)10(18)24)20(3)8-7(19(31)33-20)11(25)13(27)14(28)12(8)26;/h1-2,29-30H;.
What are the key properties of CID 170842674?
CID 170842674 has a molecular weight of 812.66 g/mol, XLogP of 8.95, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 170842674 is sourced from PubChem (CID 170842674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).