About dihydrogen borate;2-hydroxyethyl(trimethyl)azanium
dihydrogen borate;2-hydroxyethyl(trimethyl)azanium (PubChem CID 170842935) has the molecular formula C5H16BNO4
and a molecular weight of 165.00 g/mol. Its IUPAC name is dihydrogen borate;2-hydroxyethyl(trimethyl)azanium.
Molecular Properties
| Compound Name | dihydrogen borate;2-hydroxyethyl(trimethyl)azanium |
| PubChem CID | 170842935 |
| Molecular Formula | C5H16BNO4 |
| Molecular Weight | 165.00 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | dihydrogen borate;2-hydroxyethyl(trimethyl)azanium |
| SMILES | C[N+](C)(C)CCO.[O-]B(O)O |
| InChI | InChI=1S/C5H14NO.BH2O3/c1-6(2,3)4-5-7;2-1(3)4/h7H,4-5H2,1-3H3;2-3H/q+1;-1 |
| InChIKey | IGEMHTGDGZOIIN-UHFFFAOYSA-N |
| XLogP | -3.00 |
| TPSA | 83.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.00 |
| LogP ≤ 5 | -3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze dihydrogen borate;2-hydroxyethyl(trimethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydrogen borate;2-hydroxyethyl(trimethyl)azanium?
The IUPAC name of dihydrogen borate;2-hydroxyethyl(trimethyl)azanium (CID 170842935) is dihydrogen borate;2-hydroxyethyl(trimethyl)azanium.
What is the SMILES notation for dihydrogen borate;2-hydroxyethyl(trimethyl)azanium?
The canonical SMILES for dihydrogen borate;2-hydroxyethyl(trimethyl)azanium is C[N+](C)(C)CCO.[O-]B(O)O.
What is the InChIKey of dihydrogen borate;2-hydroxyethyl(trimethyl)azanium?
The InChIKey is IGEMHTGDGZOIIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14NO.BH2O3/c1-6(2,3)4-5-7;2-1(3)4/h7H,4-5H2,1-3H3;2-3H/q+1;-1.
What are the key properties of dihydrogen borate;2-hydroxyethyl(trimethyl)azanium?
dihydrogen borate;2-hydroxyethyl(trimethyl)azanium has a molecular weight of 165.00 g/mol, XLogP of -3.00, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dihydrogen borate;2-hydroxyethyl(trimethyl)azanium is sourced from PubChem (CID 170842935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).