About 3-[(Z)-17-(benzylamino)heptadec-8-enyl]pentane-1,5-diol;hydrochloride
3-[(Z)-17-(benzylamino)heptadec-8-enyl]pentane-1,5-diol;hydrochloride (PubChem CID 170843383) has the molecular formula C29H52ClNO2
and a molecular weight of 482.19 g/mol. Its IUPAC name is 3-[(Z)-17-(benzylamino)heptadec-8-enyl]pentane-1,5-diol;hydrochloride.
Molecular Properties
| Compound Name | 3-[(Z)-17-(benzylamino)heptadec-8-enyl]pentane-1,5-diol;hydrochloride |
| PubChem CID | 170843383 |
| Molecular Formula | C29H52ClNO2 |
| Molecular Weight | 482.19 g/mol |
| Exact Mass | 481.37 |
| IUPAC Name | 3-[(Z)-17-(benzylamino)heptadec-8-enyl]pentane-1,5-diol;hydrochloride |
| SMILES | Cl.OCCC(CCO)CCCCCCC/C=C\CCCCCCCCNCc1ccccc1 |
| InChI | InChI=1S/C29H51NO2.ClH/c31-25-22-28(23-26-32)19-15-12-10-8-6-4-2-1-3-5-7-9-11-13-18-24-30-27-29-20-16-14-17-21-29;/h1-2,14,16-17,20-21,28,30-32H,3-13,15,18-19,22-27H2;1H/b2-1-; |
| InChIKey | AQXOGKZOULUCAD-ODZAUARKSA-N |
| XLogP | 7.60 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 482.19 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(Z)-17-(benzylamino)heptadec-8-enyl]pentane-1,5-diol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(Z)-17-(benzylamino)heptadec-8-enyl]pentane-1,5-diol;hydrochloride?
The IUPAC name of 3-[(Z)-17-(benzylamino)heptadec-8-enyl]pentane-1,5-diol;hydrochloride (CID 170843383) is 3-[(Z)-17-(benzylamino)heptadec-8-enyl]pentane-1,5-diol;hydrochloride.
What is the SMILES notation for 3-[(Z)-17-(benzylamino)heptadec-8-enyl]pentane-1,5-diol;hydrochloride?
The canonical SMILES for 3-[(Z)-17-(benzylamino)heptadec-8-enyl]pentane-1,5-diol;hydrochloride is Cl.OCCC(CCO)CCCCCCC/C=C\CCCCCCCCNCc1ccccc1.
What is the InChIKey of 3-[(Z)-17-(benzylamino)heptadec-8-enyl]pentane-1,5-diol;hydrochloride?
The InChIKey is AQXOGKZOULUCAD-ODZAUARKSA-N. The full InChI is InChI=1S/C29H51NO2.ClH/c31-25-22-28(23-26-32)19-15-12-10-8-6-4-2-1-3-5-7-9-11-13-18-24-30-27-29-20-16-14-17-21-29;/h1-2,14,16-17,20-21,28,30-32H,3-13,15,18-19,22-27H2;1H/b2-1-;.
What are the key properties of 3-[(Z)-17-(benzylamino)heptadec-8-enyl]pentane-1,5-diol;hydrochloride?
3-[(Z)-17-(benzylamino)heptadec-8-enyl]pentane-1,5-diol;hydrochloride has a molecular weight of 482.19 g/mol, XLogP of 7.60, 23 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(Z)-17-(benzylamino)heptadec-8-enyl]pentane-1,5-diol;hydrochloride is sourced from PubChem (CID 170843383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).