About CID 170843971
CID 170843971 (PubChem CID 170843971) has the molecular formula C8H19K2O4P
and a molecular weight of 288.41 g/mol.
Molecular Properties
| Compound Name | CID 170843971 |
| PubChem CID | 170843971 |
| Molecular Formula | C8H19K2O4P |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | — |
| SMILES | CCCCCCCCOP(=O)(O)O.[K].[K] |
| InChI | InChI=1S/C8H19O4P.2K/c1-2-3-4-5-6-7-8-12-13(9,10)11;;/h2-8H2,1H3,(H2,9,10,11);; |
| InChIKey | SQEKEJVXOKDSCP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 170843971 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 170843971?
The IUPAC name of CID 170843971 (CID 170843971) is not available.
What is the SMILES notation for CID 170843971?
The canonical SMILES for CID 170843971 is CCCCCCCCOP(=O)(O)O.[K].[K].
What is the InChIKey of CID 170843971?
The InChIKey is SQEKEJVXOKDSCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19O4P.2K/c1-2-3-4-5-6-7-8-12-13(9,10)11;;/h2-8H2,1H3,(H2,9,10,11);;.
What are the key properties of CID 170843971?
CID 170843971 has a molecular weight of 288.41 g/mol, XLogP of 1.69, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 170843971 is sourced from PubChem (CID 170843971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).