C9H17N2O+ — CID 170843996
(2,2,5,5-tetramethyl-1H-pyrrole-3-carbonyl)azanium (PubChem CID 170843996) has the molecular formula C9H17N2O+ and a molecular weight of 169.25 g/mol. Its IUPAC name is (2,2,5,5-tetramethyl-1H-pyrrole-3-carbonyl)azanium.
| Compound Name | (2,2,5,5-tetramethyl-1H-pyrrole-3-carbonyl)azanium |
|---|---|
| PubChem CID | 170843996 |
| Molecular Formula | C9H17N2O+ |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.13 |
| IUPAC Name | (2,2,5,5-tetramethyl-1H-pyrrole-3-carbonyl)azanium |
| SMILES | CC1(C)C=C(C([NH3+])=O)C(C)(C)N1 |
| InChI | InChI=1S/C9H16N2O/c1-8(2)5-6(7(10)12)9(3,4)11-8/h5,11H,1-4H3,(H2,10,12)/p+1 |
| InChIKey | ACFYUJLIWIDSFM-UHFFFAOYSA-O |
| XLogP | -0.16 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |