About CID 170844802
CID 170844802 (PubChem CID 170844802) has the molecular formula C10H20NaO4S
and a molecular weight of 259.32 g/mol.
Molecular Properties
| Compound Name | CID 170844802 |
| PubChem CID | 170844802 |
| Molecular Formula | C10H20NaO4S |
| Molecular Weight | 259.32 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | — |
| SMILES | CC(C)=CCCC(C)CC(O)S(=O)(=O)O.[Na] |
| InChI | InChI=1S/C10H20O4S.Na/c1-8(2)5-4-6-9(3)7-10(11)15(12,13)14;/h5,9-11H,4,6-7H2,1-3H3,(H,12,13,14); |
| InChIKey | ROPONQCQZKDNCN-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze CID 170844802 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 170844802?
The IUPAC name of CID 170844802 (CID 170844802) is not available.
What is the SMILES notation for CID 170844802?
The canonical SMILES for CID 170844802 is CC(C)=CCCC(C)CC(O)S(=O)(=O)O.[Na].
What is the InChIKey of CID 170844802?
The InChIKey is ROPONQCQZKDNCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O4S.Na/c1-8(2)5-4-6-9(3)7-10(11)15(12,13)14;/h5,9-11H,4,6-7H2,1-3H3,(H,12,13,14);.
What are the key properties of CID 170844802?
CID 170844802 has a molecular weight of 259.32 g/mol, XLogP of 1.58, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 170844802 is sourced from PubChem (CID 170844802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).