About sodium (2Z,6E)-2-hydroxyimino-6-oxidoiminocyclohex-4-ene-1,3-dione
sodium (2Z,6E)-2-hydroxyimino-6-oxidoiminocyclohex-4-ene-1,3-dione (PubChem CID 170845029) has the molecular formula C6H3N2NaO4
and a molecular weight of 190.09 g/mol. Its IUPAC name is sodium (2Z,6E)-2-hydroxyimino-6-oxidoiminocyclohex-4-ene-1,3-dione.
Molecular Properties
| Compound Name | sodium (2Z,6E)-2-hydroxyimino-6-oxidoiminocyclohex-4-ene-1,3-dione |
| PubChem CID | 170845029 |
| Molecular Formula | C6H3N2NaO4 |
| Molecular Weight | 190.09 g/mol |
| Exact Mass | 190.00 |
| IUPAC Name | sodium (2Z,6E)-2-hydroxyimino-6-oxidoiminocyclohex-4-ene-1,3-dione |
| SMILES | O=c1cc/c(=N\[O-])c(=O)/c1=N\O.[Na+] |
| InChI | InChI=1S/C6H4N2O4.Na/c9-4-2-1-3(7-11)6(10)5(4)8-12;/h1-2,11-12H;/q;+1/p-1/b7-3+,8-5-; |
| InChIKey | AJIDYBCHZMTJDA-YKXWHEBCSA-M |
| XLogP | -5.03 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.09 |
| LogP ≤ 5 | -5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium (2Z,6E)-2-hydroxyimino-6-oxidoiminocyclohex-4-ene-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium (2Z,6E)-2-hydroxyimino-6-oxidoiminocyclohex-4-ene-1,3-dione?
The IUPAC name of sodium (2Z,6E)-2-hydroxyimino-6-oxidoiminocyclohex-4-ene-1,3-dione (CID 170845029) is sodium (2Z,6E)-2-hydroxyimino-6-oxidoiminocyclohex-4-ene-1,3-dione.
What is the SMILES notation for sodium (2Z,6E)-2-hydroxyimino-6-oxidoiminocyclohex-4-ene-1,3-dione?
The canonical SMILES for sodium (2Z,6E)-2-hydroxyimino-6-oxidoiminocyclohex-4-ene-1,3-dione is O=c1cc/c(=N\[O-])c(=O)/c1=N\O.[Na+].
What is the InChIKey of sodium (2Z,6E)-2-hydroxyimino-6-oxidoiminocyclohex-4-ene-1,3-dione?
The InChIKey is AJIDYBCHZMTJDA-YKXWHEBCSA-M. The full InChI is InChI=1S/C6H4N2O4.Na/c9-4-2-1-3(7-11)6(10)5(4)8-12;/h1-2,11-12H;/q;+1/p-1/b7-3+,8-5-;.
What are the key properties of sodium (2Z,6E)-2-hydroxyimino-6-oxidoiminocyclohex-4-ene-1,3-dione?
sodium (2Z,6E)-2-hydroxyimino-6-oxidoiminocyclohex-4-ene-1,3-dione has a molecular weight of 190.09 g/mol, XLogP of -5.03, 0 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium (2Z,6E)-2-hydroxyimino-6-oxidoiminocyclohex-4-ene-1,3-dione is sourced from PubChem (CID 170845029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).