About zinc bis(6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate)
zinc bis(6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate) (PubChem CID 170845352) has the molecular formula C18H18O8Zn
and a molecular weight of 427.72 g/mol. Its IUPAC name is zinc bis(6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate).
Molecular Properties
| Compound Name | zinc bis(6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate) |
| PubChem CID | 170845352 |
| Molecular Formula | C18H18O8Zn |
| Molecular Weight | 427.72 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | zinc bis(6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate) |
| SMILES | CC(=O)C1(O)C=CC=CC1C(=O)[O-].CC(=O)C1(O)C=CC=CC1C(=O)[O-].[Zn+2] |
| InChI | InChI=1S/2C9H10O4.Zn/c2*1-6(10)9(13)5-3-2-4-7(9)8(11)12;/h2*2-5,7,13H,1H3,(H,11,12);/q;;+2/p-2 |
| InChIKey | GZPXHMJPGWIANJ-UHFFFAOYSA-L |
| XLogP | -2.41 |
| TPSA | 154.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.72 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc bis(6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc bis(6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate)?
The IUPAC name of zinc bis(6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate) (CID 170845352) is zinc bis(6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate).
What is the SMILES notation for zinc bis(6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate)?
The canonical SMILES for zinc bis(6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate) is CC(=O)C1(O)C=CC=CC1C(=O)[O-].CC(=O)C1(O)C=CC=CC1C(=O)[O-].[Zn+2].
What is the InChIKey of zinc bis(6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate)?
The InChIKey is GZPXHMJPGWIANJ-UHFFFAOYSA-L. The full InChI is InChI=1S/2C9H10O4.Zn/c2*1-6(10)9(13)5-3-2-4-7(9)8(11)12;/h2*2-5,7,13H,1H3,(H,11,12);/q;;+2/p-2.
What are the key properties of zinc bis(6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate)?
zinc bis(6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate) has a molecular weight of 427.72 g/mol, XLogP of -2.41, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for zinc bis(6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate) is sourced from PubChem (CID 170845352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).