C20H22N2O4 — CID 170845576
(Z)-but-2-enedioic acid;2-methyltricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene-2,9-diamine (PubChem CID 170845576) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;2-methyltricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene-2,9-diamine.
| Compound Name | (Z)-but-2-enedioic acid;2-methyltricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene-2,9-diamine |
|---|---|
| PubChem CID | 170845576 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | (Z)-but-2-enedioic acid;2-methyltricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene-2,9-diamine |
| SMILES | CC1(N)c2ccccc2CC(N)c2ccccc21.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C16H18N2.C4H4O4/c1-16(18)13-8-4-2-6-11(13)10-15(17)12-7-3-5-9-14(12)16;5-3(6)1-2-4(7)8/h2-9,15H,10,17-18H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | DLYTVPVTTHCHHV-BTJKTKAUSA-N |
| XLogP | 2.18 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|