C36H33NO8 — CID 170845577
(2S,3S)-2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid;(1S,9R)-1-methyl-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaene (PubChem CID 170845577) has the molecular formula C36H33NO8 and a molecular weight of 607.66 g/mol. Its IUPAC name is (2S,3S)-2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid;(1S,9R)-1-methyl-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaene.
| Compound Name | (2S,3S)-2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid;(1S,9R)-1-methyl-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaene |
|---|---|
| PubChem CID | 170845577 |
| Molecular Formula | C36H33NO8 |
| Molecular Weight | 607.66 g/mol |
| Exact Mass | 607.22 |
| IUPAC Name | (2S,3S)-2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid;(1S,9R)-1-methyl-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaene |
| SMILES | C[C@]12N[C@H](Cc3ccccc31)c1ccccc12.Cc1ccc(C(=O)O[C@H](C(=O)O)[C@H](OC(=O)c2ccc(C)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C20H18O8.C16H15N/c1-11-3-7-13(8-4-11)19(25)27-15(17(21)22)16(18(23)24)28-20(26)14-9-5-12(2)6-10-14;1-16-13-8-4-2-6-11(13)10-15(17-16)12-7-3-5-9-14(12)16/h3-10,15-16H,1-2H3,(H,21,22)(H,23,24);2-9,15,17H,10H2,1H3/t15-,16-;15-,16+/m01/s1 |
| InChIKey | WPQFSZXXIYOEJV-HBSNKKDKSA-N |
| XLogP | 5.37 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.66 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |