C31H24ClN7O10S3 — CID 170846505
(3Z)-5-[[6-chloro-4-(2-ethylphenyl)imino-1H-1,3,5-triazin-2-ylidene]amino]-4-oxo-3-[(1-sulfonaphthalen-2-yl)hydrazinylidene]naphthalene-2,7-disulfonic acid (PubChem CID 170846505) has the molecular formula C31H24ClN7O10S3 and a molecular weight of 786.23 g/mol. Its IUPAC name is (3Z)-5-[[6-chloro-4-(2-ethylphenyl)imino-1H-1,3,5-triazin-2-ylidene]amino]-4-oxo-3-[(1-sulfonaphthalen-2-yl)hydrazinylidene]naphthalene-2,7-disulfonic acid.
| Compound Name | (3Z)-5-[[6-chloro-4-(2-ethylphenyl)imino-1H-1,3,5-triazin-2-ylidene]amino]-4-oxo-3-[(1-sulfonaphthalen-2-yl)hydrazinylidene]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 170846505 |
| Molecular Formula | C31H24ClN7O10S3 |
| Molecular Weight | 786.23 g/mol |
| Exact Mass | 785.04 |
| IUPAC Name | (3Z)-5-[[6-chloro-4-(2-ethylphenyl)imino-1H-1,3,5-triazin-2-ylidene]amino]-4-oxo-3-[(1-sulfonaphthalen-2-yl)hydrazinylidene]naphthalene-2,7-disulfonic acid |
| SMILES | CCc1ccccc1/N=c1\nc(Cl)[nH]/c(=N/c2cc(S(=O)(=O)O)cc3c2C(=O)/C(=N/Nc2ccc4ccccc4c2S(=O)(=O)O)C(S(=O)(=O)O)=C3)[nH]1 |
| InChI | InChI=1S/C31H24ClN7O10S3/c1-2-16-7-4-6-10-21(16)33-30-35-29(32)36-31(37-30)34-23-15-19(50(41,42)43)13-18-14-24(51(44,45)46)26(27(40)25(18)23)39-38-22-12-11-17-8-3-5-9-20(17)28(22)52(47,48)49/h3-15,38H,2H2,1H3,(H,41,42,43)(H,44,45,46)(H,47,48,49)(H2,33,34,35,36,37)/b39-26+ |
| InChIKey | BVSAVKXZFSSJDS-JBFMKSPFSA-N |
| XLogP | 3.96 |
| TPSA | 273.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.23 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|