C19H23N6NaO14S4 — CID 170847057
sodium 2-[[3-cyano-4-methyl-6-(2-sulfooxyethylamino)-5-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-2-pyridinyl]amino]ethyl sulfate (PubChem CID 170847057) has the molecular formula C19H23N6NaO14S4 and a molecular weight of 710.68 g/mol. Its IUPAC name is sodium 2-[[3-cyano-4-methyl-6-(2-sulfooxyethylamino)-5-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-2-pyridinyl]amino]ethyl sulfate.
| Compound Name | sodium 2-[[3-cyano-4-methyl-6-(2-sulfooxyethylamino)-5-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-2-pyridinyl]amino]ethyl sulfate |
|---|---|
| PubChem CID | 170847057 |
| Molecular Formula | C19H23N6NaO14S4 |
| Molecular Weight | 710.68 g/mol |
| Exact Mass | 710.01 |
| IUPAC Name | sodium 2-[[3-cyano-4-methyl-6-(2-sulfooxyethylamino)-5-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-2-pyridinyl]amino]ethyl sulfate |
| SMILES | Cc1c(C#N)c(NCCOS(=O)(=O)[O-])nc(NCCOS(=O)(=O)O)c1/N=N/c1ccc(S(=O)(=O)CCOS(=O)(=O)O)cc1.[Na+] |
| InChI | InChI=1S/C19H24N6O14S4.Na/c1-13-16(12-20)18(21-6-8-37-41(28,29)30)23-19(22-7-9-38-42(31,32)33)17(13)25-24-14-2-4-15(5-3-14)40(26,27)11-10-39-43(34,35)36;/h2-5H,6-11H2,1H3,(H2,21,22,23)(H,28,29,30)(H,31,32,33)(H,34,35,36);/q;+1/p-1/b25-24+; |
| InChIKey | QGAARQJCGSHJDQ-QREUMGABSA-M |
| XLogP | -2.61 |
| TPSA | 313.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.68 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|