About CID 170847227
CID 170847227 (PubChem CID 170847227) has the molecular formula C6H8CoKO7
and a molecular weight of 290.15 g/mol.
Molecular Properties
| Compound Name | CID 170847227 |
| PubChem CID | 170847227 |
| Molecular Formula | C6H8CoKO7 |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 289.92 |
| IUPAC Name | — |
| SMILES | O=C(O)CC(O)(CC(=O)O)C(=O)O.[Co].[K] |
| InChI | InChI=1S/C6H8O7.Co.K/c7-3(8)1-6(13,5(11)12)2-4(9)10;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);; |
| InChIKey | NETYWGFIQMMTSG-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 170847227 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 170847227?
The IUPAC name of CID 170847227 (CID 170847227) is not available.
What is the SMILES notation for CID 170847227?
The canonical SMILES for CID 170847227 is O=C(O)CC(O)(CC(=O)O)C(=O)O.[Co].[K].
What is the InChIKey of CID 170847227?
The InChIKey is NETYWGFIQMMTSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O7.Co.K/c7-3(8)1-6(13,5(11)12)2-4(9)10;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;.
What are the key properties of CID 170847227?
CID 170847227 has a molecular weight of 290.15 g/mol, XLogP of -1.63, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 170847227 is sourced from PubChem (CID 170847227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).