C16H2CaCl8O8 — CID 170847231
calcium;3,4,5,6-tetrachlorophthalate;3,4,5,6-tetrachlorophthalic acid (PubChem CID 170847231) has the molecular formula C16H2CaCl8O8 and a molecular weight of 645.89 g/mol. Its IUPAC name is calcium;3,4,5,6-tetrachlorophthalate;3,4,5,6-tetrachlorophthalic acid.
| Compound Name | calcium;3,4,5,6-tetrachlorophthalate;3,4,5,6-tetrachlorophthalic acid |
|---|---|
| PubChem CID | 170847231 |
| Molecular Formula | C16H2CaCl8O8 |
| Molecular Weight | 645.89 g/mol |
| Exact Mass | 641.69 |
| IUPAC Name | calcium;3,4,5,6-tetrachlorophthalate;3,4,5,6-tetrachlorophthalic acid |
| SMILES | O=C(O)c1c(Cl)c(Cl)c(Cl)c(Cl)c1C(=O)O.O=C([O-])c1c(Cl)c(Cl)c(Cl)c(Cl)c1C(=O)[O-].[Ca+2] |
| InChI | InChI=1S/2C8H2Cl4O4.Ca/c2*9-3-1(7(13)14)2(8(15)16)4(10)6(12)5(3)11;/h2*(H,13,14)(H,15,16);/q;;+2/p-2 |
| InChIKey | UORLIJOZQJVHRZ-UHFFFAOYSA-L |
| XLogP | 4.34 |
| TPSA | 154.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.89 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|