About propan-2-olate;titanium(3+);dichloride
propan-2-olate;titanium(3+);dichloride (PubChem CID 170847368) has the molecular formula C3H7Cl2OTi
and a molecular weight of 177.86 g/mol. Its IUPAC name is propan-2-olate;titanium(3+);dichloride.
Molecular Properties
| Compound Name | propan-2-olate;titanium(3+);dichloride |
| PubChem CID | 170847368 |
| Molecular Formula | C3H7Cl2OTi |
| Molecular Weight | 177.86 g/mol |
| Exact Mass | 176.94 |
| IUPAC Name | propan-2-olate;titanium(3+);dichloride |
| SMILES | CC(C)[O-].[Cl-].[Cl-].[Ti+3] |
| InChI | InChI=1S/C3H7O.2ClH.Ti/c1-3(2)4;;;/h3H,1-2H3;2*1H;/q-1;;;+3/p-2 |
| InChIKey | JUTZGYSJFAXFBY-UHFFFAOYSA-L |
| XLogP | -6.24 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.86 |
| LogP ≤ 5 | -6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze propan-2-olate;titanium(3+);dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-olate;titanium(3+);dichloride?
The IUPAC name of propan-2-olate;titanium(3+);dichloride (CID 170847368) is propan-2-olate;titanium(3+);dichloride.
What is the SMILES notation for propan-2-olate;titanium(3+);dichloride?
The canonical SMILES for propan-2-olate;titanium(3+);dichloride is CC(C)[O-].[Cl-].[Cl-].[Ti+3].
What is the InChIKey of propan-2-olate;titanium(3+);dichloride?
The InChIKey is JUTZGYSJFAXFBY-UHFFFAOYSA-L. The full InChI is InChI=1S/C3H7O.2ClH.Ti/c1-3(2)4;;;/h3H,1-2H3;2*1H;/q-1;;;+3/p-2.
What are the key properties of propan-2-olate;titanium(3+);dichloride?
propan-2-olate;titanium(3+);dichloride has a molecular weight of 177.86 g/mol, XLogP of -6.24, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-olate;titanium(3+);dichloride is sourced from PubChem (CID 170847368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).