About 1,3-dioxo-2-benzofuran-5-carboxylic acid;1-isocyanato-4-(4-isocyanatophenoxy)benzene
1,3-dioxo-2-benzofuran-5-carboxylic acid;1-isocyanato-4-(4-isocyanatophenoxy)benzene (PubChem CID 170847894) has the molecular formula C23H12N2O8
and a molecular weight of 444.36 g/mol. Its IUPAC name is 1,3-dioxo-2-benzofuran-5-carboxylic acid;1-isocyanato-4-(4-isocyanatophenoxy)benzene.
Molecular Properties
| Compound Name | 1,3-dioxo-2-benzofuran-5-carboxylic acid;1-isocyanato-4-(4-isocyanatophenoxy)benzene |
| PubChem CID | 170847894 |
| Molecular Formula | C23H12N2O8 |
| Molecular Weight | 444.36 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 1,3-dioxo-2-benzofuran-5-carboxylic acid;1-isocyanato-4-(4-isocyanatophenoxy)benzene |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)OC2=O.O=C=Nc1ccc(Oc2ccc(N=C=O)cc2)cc1 |
| InChI | InChI=1S/C14H8N2O3.C9H4O5/c17-9-15-11-1-5-13(6-2-11)19-14-7-3-12(4-8-14)16-10-18;10-7(11)4-1-2-5-6(3-4)9(13)14-8(5)12/h1-8H;1-3H,(H,10,11) |
| InChIKey | WQHZZAKOGHEYBF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 148.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.36 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dioxo-2-benzofuran-5-carboxylic acid;1-isocyanato-4-(4-isocyanatophenoxy)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dioxo-2-benzofuran-5-carboxylic acid;1-isocyanato-4-(4-isocyanatophenoxy)benzene?
The IUPAC name of 1,3-dioxo-2-benzofuran-5-carboxylic acid;1-isocyanato-4-(4-isocyanatophenoxy)benzene (CID 170847894) is 1,3-dioxo-2-benzofuran-5-carboxylic acid;1-isocyanato-4-(4-isocyanatophenoxy)benzene.
What is the SMILES notation for 1,3-dioxo-2-benzofuran-5-carboxylic acid;1-isocyanato-4-(4-isocyanatophenoxy)benzene?
The canonical SMILES for 1,3-dioxo-2-benzofuran-5-carboxylic acid;1-isocyanato-4-(4-isocyanatophenoxy)benzene is O=C(O)c1ccc2c(c1)C(=O)OC2=O.O=C=Nc1ccc(Oc2ccc(N=C=O)cc2)cc1.
What is the InChIKey of 1,3-dioxo-2-benzofuran-5-carboxylic acid;1-isocyanato-4-(4-isocyanatophenoxy)benzene?
The InChIKey is WQHZZAKOGHEYBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8N2O3.C9H4O5/c17-9-15-11-1-5-13(6-2-11)19-14-7-3-12(4-8-14)16-10-18;10-7(11)4-1-2-5-6(3-4)9(13)14-8(5)12/h1-8H;1-3H,(H,10,11).
What are the key properties of 1,3-dioxo-2-benzofuran-5-carboxylic acid;1-isocyanato-4-(4-isocyanatophenoxy)benzene?
1,3-dioxo-2-benzofuran-5-carboxylic acid;1-isocyanato-4-(4-isocyanatophenoxy)benzene has a molecular weight of 444.36 g/mol, XLogP of 4.11, 5 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dioxo-2-benzofuran-5-carboxylic acid;1-isocyanato-4-(4-isocyanatophenoxy)benzene is sourced from PubChem (CID 170847894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).