About N,N-diethyl-3,7,11-trimethyldodec-1-en-1-amine
N,N-diethyl-3,7,11-trimethyldodec-1-en-1-amine (PubChem CID 170847923) has the molecular formula C19H39N
and a molecular weight of 281.53 g/mol. Its IUPAC name is N,N-diethyl-3,7,11-trimethyldodec-1-en-1-amine.
Molecular Properties
| Compound Name | N,N-diethyl-3,7,11-trimethyldodec-1-en-1-amine |
| PubChem CID | 170847923 |
| Molecular Formula | C19H39N |
| Molecular Weight | 281.53 g/mol |
| Exact Mass | 281.31 |
| IUPAC Name | N,N-diethyl-3,7,11-trimethyldodec-1-en-1-amine |
| SMILES | CCN(C=CC(C)CCCC(C)CCCC(C)C)CC |
| InChI | InChI=1S/C19H39N/c1-7-20(8-2)16-15-19(6)14-10-13-18(5)12-9-11-17(3)4/h15-19H,7-14H2,1-6H3 |
| InChIKey | AXYPUWJROWJZMW-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 281.53 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-diethyl-3,7,11-trimethyldodec-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-3,7,11-trimethyldodec-1-en-1-amine?
The IUPAC name of N,N-diethyl-3,7,11-trimethyldodec-1-en-1-amine (CID 170847923) is N,N-diethyl-3,7,11-trimethyldodec-1-en-1-amine.
What is the SMILES notation for N,N-diethyl-3,7,11-trimethyldodec-1-en-1-amine?
The canonical SMILES for N,N-diethyl-3,7,11-trimethyldodec-1-en-1-amine is CCN(C=CC(C)CCCC(C)CCCC(C)C)CC.
What is the InChIKey of N,N-diethyl-3,7,11-trimethyldodec-1-en-1-amine?
The InChIKey is AXYPUWJROWJZMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H39N/c1-7-20(8-2)16-15-19(6)14-10-13-18(5)12-9-11-17(3)4/h15-19H,7-14H2,1-6H3.
What are the key properties of N,N-diethyl-3,7,11-trimethyldodec-1-en-1-amine?
N,N-diethyl-3,7,11-trimethyldodec-1-en-1-amine has a molecular weight of 281.53 g/mol, XLogP of 6.11, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-3,7,11-trimethyldodec-1-en-1-amine is sourced from PubChem (CID 170847923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).