About N-butyl-2,4,4-trimethyl-N-pentylpentan-2-amine
N-butyl-2,4,4-trimethyl-N-pentylpentan-2-amine (PubChem CID 170848139) has the molecular formula C17H37N
and a molecular weight of 255.49 g/mol. Its IUPAC name is N-butyl-2,4,4-trimethyl-N-pentylpentan-2-amine.
Molecular Properties
| Compound Name | N-butyl-2,4,4-trimethyl-N-pentylpentan-2-amine |
| PubChem CID | 170848139 |
| Molecular Formula | C17H37N |
| Molecular Weight | 255.49 g/mol |
| Exact Mass | 255.29 |
| IUPAC Name | N-butyl-2,4,4-trimethyl-N-pentylpentan-2-amine |
| SMILES | CCCCCN(CCCC)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C17H37N/c1-8-10-12-14-18(13-11-9-2)17(6,7)15-16(3,4)5/h8-15H2,1-7H3 |
| InChIKey | DIBWERUTGVTERO-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 255.49 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-2,4,4-trimethyl-N-pentylpentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-2,4,4-trimethyl-N-pentylpentan-2-amine?
The IUPAC name of N-butyl-2,4,4-trimethyl-N-pentylpentan-2-amine (CID 170848139) is N-butyl-2,4,4-trimethyl-N-pentylpentan-2-amine.
What is the SMILES notation for N-butyl-2,4,4-trimethyl-N-pentylpentan-2-amine?
The canonical SMILES for N-butyl-2,4,4-trimethyl-N-pentylpentan-2-amine is CCCCCN(CCCC)C(C)(C)CC(C)(C)C.
What is the InChIKey of N-butyl-2,4,4-trimethyl-N-pentylpentan-2-amine?
The InChIKey is DIBWERUTGVTERO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H37N/c1-8-10-12-14-18(13-11-9-2)17(6,7)15-16(3,4)5/h8-15H2,1-7H3.
What are the key properties of N-butyl-2,4,4-trimethyl-N-pentylpentan-2-amine?
N-butyl-2,4,4-trimethyl-N-pentylpentan-2-amine has a molecular weight of 255.49 g/mol, XLogP of 5.49, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-2,4,4-trimethyl-N-pentylpentan-2-amine is sourced from PubChem (CID 170848139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).