About (9R)-9-methylicosane
(9R)-9-methylicosane (PubChem CID 170848391) has the molecular formula C21H44
and a molecular weight of 296.58 g/mol. Its IUPAC name is (9R)-9-methylicosane.
Molecular Properties
| Compound Name | (9R)-9-methylicosane |
| PubChem CID | 170848391 |
| Molecular Formula | C21H44 |
| Molecular Weight | 296.58 g/mol |
| Exact Mass | 296.34 |
| IUPAC Name | (9R)-9-methylicosane |
| SMILES | CCCCCCCCCCC[C@H](C)CCCCCCCC |
| InChI | InChI=1S/C21H44/c1-4-6-8-10-12-13-14-16-18-20-21(3)19-17-15-11-9-7-5-2/h21H,4-20H2,1-3H3/t21-/m1/s1 |
| InChIKey | BLABZBZRIQVOBV-OAQYLSRUSA-N |
| XLogP | 8.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.58 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (9R)-9-methylicosane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9R)-9-methylicosane?
The IUPAC name of (9R)-9-methylicosane (CID 170848391) is (9R)-9-methylicosane.
What is the SMILES notation for (9R)-9-methylicosane?
The canonical SMILES for (9R)-9-methylicosane is CCCCCCCCCCC[C@H](C)CCCCCCCC.
What is the InChIKey of (9R)-9-methylicosane?
The InChIKey is BLABZBZRIQVOBV-OAQYLSRUSA-N. The full InChI is InChI=1S/C21H44/c1-4-6-8-10-12-13-14-16-18-20-21(3)19-17-15-11-9-7-5-2/h21H,4-20H2,1-3H3/t21-/m1/s1.
What are the key properties of (9R)-9-methylicosane?
(9R)-9-methylicosane has a molecular weight of 296.58 g/mol, XLogP of 8.29, 17 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (9R)-9-methylicosane is sourced from PubChem (CID 170848391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).