C12H24O — CID 170848474
2,6,8-trimethylnon-1-en-3-ol (PubChem CID 170848474) has the molecular formula C12H24O and a molecular weight of 184.32 g/mol. Its IUPAC name is 2,6,8-trimethylnon-1-en-3-ol.
| Compound Name | 2,6,8-trimethylnon-1-en-3-ol |
|---|---|
| PubChem CID | 170848474 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | 2,6,8-trimethylnon-1-en-3-ol |
| SMILES | C=C(C)C(O)CCC(C)CC(C)C |
| InChI | InChI=1S/C12H24O/c1-9(2)8-11(5)6-7-12(13)10(3)4/h9,11-13H,3,6-8H2,1-2,4-5H3 |
| InChIKey | FZGCZEGCRRPQIN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|