About disodium;2-hydroxypropyl phosphate
disodium;2-hydroxypropyl phosphate (PubChem CID 170848495) has the molecular formula C3H7Na2O5P
and a molecular weight of 200.04 g/mol. Its IUPAC name is disodium;2-hydroxypropyl phosphate.
Molecular Properties
| Compound Name | disodium;2-hydroxypropyl phosphate |
| PubChem CID | 170848495 |
| Molecular Formula | C3H7Na2O5P |
| Molecular Weight | 200.04 g/mol |
| Exact Mass | 199.98 |
| IUPAC Name | disodium;2-hydroxypropyl phosphate |
| SMILES | CC(O)COP(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C3H9O5P.2Na/c1-3(4)2-8-9(5,6)7;;/h3-4H,2H2,1H3,(H2,5,6,7);;/q;2*+1/p-2 |
| InChIKey | ZVOXTSRVZYXTDD-UHFFFAOYSA-L |
| XLogP | -7.78 |
| TPSA | 92.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.04 |
| LogP ≤ 5 | -7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze disodium;2-hydroxypropyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;2-hydroxypropyl phosphate?
The IUPAC name of disodium;2-hydroxypropyl phosphate (CID 170848495) is disodium;2-hydroxypropyl phosphate.
What is the SMILES notation for disodium;2-hydroxypropyl phosphate?
The canonical SMILES for disodium;2-hydroxypropyl phosphate is CC(O)COP(=O)([O-])[O-].[Na+].[Na+].
What is the InChIKey of disodium;2-hydroxypropyl phosphate?
The InChIKey is ZVOXTSRVZYXTDD-UHFFFAOYSA-L. The full InChI is InChI=1S/C3H9O5P.2Na/c1-3(4)2-8-9(5,6)7;;/h3-4H,2H2,1H3,(H2,5,6,7);;/q;2*+1/p-2.
What are the key properties of disodium;2-hydroxypropyl phosphate?
disodium;2-hydroxypropyl phosphate has a molecular weight of 200.04 g/mol, XLogP of -7.78, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;2-hydroxypropyl phosphate is sourced from PubChem (CID 170848495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).