C13H25Br — CID 170848499
(E)-5-bromo-2,2,3,5,6,6-hexamethylhept-3-ene (PubChem CID 170848499) has the molecular formula C13H25Br and a molecular weight of 261.25 g/mol. Its IUPAC name is (E)-5-bromo-2,2,3,5,6,6-hexamethylhept-3-ene.
| Compound Name | (E)-5-bromo-2,2,3,5,6,6-hexamethylhept-3-ene |
|---|---|
| PubChem CID | 170848499 |
| Molecular Formula | C13H25Br |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | (E)-5-bromo-2,2,3,5,6,6-hexamethylhept-3-ene |
| SMILES | C/C(=C\C(C)(Br)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H25Br/c1-10(11(2,3)4)9-13(8,14)12(5,6)7/h9H,1-8H3/b10-9+ |
| InChIKey | NKPUCLKESULDQI-MDZDMXLPSA-N |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|