C12H24O — CID 170848560
(E,2R,3S)-3,8,8-trimethylnon-5-en-2-ol (PubChem CID 170848560) has the molecular formula C12H24O and a molecular weight of 184.32 g/mol. Its IUPAC name is (E,2R,3S)-3,8,8-trimethylnon-5-en-2-ol.
| Compound Name | (E,2R,3S)-3,8,8-trimethylnon-5-en-2-ol |
|---|---|
| PubChem CID | 170848560 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | (E,2R,3S)-3,8,8-trimethylnon-5-en-2-ol |
| SMILES | C[C@@H](O)[C@@H](C)C/C=C/CC(C)(C)C |
| InChI | InChI=1S/C12H24O/c1-10(11(2)13)8-6-7-9-12(3,4)5/h6-7,10-11,13H,8-9H2,1-5H3/b7-6+/t10-,11+/m0/s1 |
| InChIKey | NBWSMOYUQDDKAG-FQLSZKSXSA-N |
| XLogP | 3.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|