About nonadec-8-en-7-ol
nonadec-8-en-7-ol (PubChem CID 170849064) has the molecular formula C19H38O
and a molecular weight of 282.51 g/mol. Its IUPAC name is nonadec-8-en-7-ol.
Molecular Properties
| Compound Name | nonadec-8-en-7-ol |
| PubChem CID | 170849064 |
| Molecular Formula | C19H38O |
| Molecular Weight | 282.51 g/mol |
| Exact Mass | 282.29 |
| IUPAC Name | nonadec-8-en-7-ol |
| SMILES | CCCCCCCCCCC=CC(O)CCCCCC |
| InChI | InChI=1S/C19H38O/c1-3-5-7-9-10-11-12-13-14-16-18-19(20)17-15-8-6-4-2/h16,18-20H,3-15,17H2,1-2H3 |
| InChIKey | QJVLIBRIDVQXJB-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.51 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze nonadec-8-en-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonadec-8-en-7-ol?
The IUPAC name of nonadec-8-en-7-ol (CID 170849064) is nonadec-8-en-7-ol.
What is the SMILES notation for nonadec-8-en-7-ol?
The canonical SMILES for nonadec-8-en-7-ol is CCCCCCCCCCC=CC(O)CCCCCC.
What is the InChIKey of nonadec-8-en-7-ol?
The InChIKey is QJVLIBRIDVQXJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H38O/c1-3-5-7-9-10-11-12-13-14-16-18-19(20)17-15-8-6-4-2/h16,18-20H,3-15,17H2,1-2H3.
What are the key properties of nonadec-8-en-7-ol?
nonadec-8-en-7-ol has a molecular weight of 282.51 g/mol, XLogP of 6.40, 15 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for nonadec-8-en-7-ol is sourced from PubChem (CID 170849064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).