About (4R,6R)-6-chloro-2,4-dimethylhept-2-ene
(4R,6R)-6-chloro-2,4-dimethylhept-2-ene (PubChem CID 170849205) has the molecular formula C9H17Cl
and a molecular weight of 160.69 g/mol. Its IUPAC name is (4R,6R)-6-chloro-2,4-dimethylhept-2-ene.
Molecular Properties
| Compound Name | (4R,6R)-6-chloro-2,4-dimethylhept-2-ene |
| PubChem CID | 170849205 |
| Molecular Formula | C9H17Cl |
| Molecular Weight | 160.69 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | (4R,6R)-6-chloro-2,4-dimethylhept-2-ene |
| SMILES | CC(C)=C[C@H](C)C[C@@H](C)Cl |
| InChI | InChI=1S/C9H17Cl/c1-7(2)5-8(3)6-9(4)10/h5,8-9H,6H2,1-4H3/t8-,9+/m0/s1 |
| InChIKey | XOHXWWRHAYWWHX-DTWKUNHWSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.69 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4R,6R)-6-chloro-2,4-dimethylhept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,6R)-6-chloro-2,4-dimethylhept-2-ene?
The IUPAC name of (4R,6R)-6-chloro-2,4-dimethylhept-2-ene (CID 170849205) is (4R,6R)-6-chloro-2,4-dimethylhept-2-ene.
What is the SMILES notation for (4R,6R)-6-chloro-2,4-dimethylhept-2-ene?
The canonical SMILES for (4R,6R)-6-chloro-2,4-dimethylhept-2-ene is CC(C)=C[C@H](C)C[C@@H](C)Cl.
What is the InChIKey of (4R,6R)-6-chloro-2,4-dimethylhept-2-ene?
The InChIKey is XOHXWWRHAYWWHX-DTWKUNHWSA-N. The full InChI is InChI=1S/C9H17Cl/c1-7(2)5-8(3)6-9(4)10/h5,8-9H,6H2,1-4H3/t8-,9+/m0/s1.
What are the key properties of (4R,6R)-6-chloro-2,4-dimethylhept-2-ene?
(4R,6R)-6-chloro-2,4-dimethylhept-2-ene has a molecular weight of 160.69 g/mol, XLogP of 3.61, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,6R)-6-chloro-2,4-dimethylhept-2-ene is sourced from PubChem (CID 170849205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).