About (3R,4R)-3,4-dimethyldec-1-en-4-ol
(3R,4R)-3,4-dimethyldec-1-en-4-ol (PubChem CID 170849264) has the molecular formula C12H24O
and a molecular weight of 184.32 g/mol. Its IUPAC name is (3R,4R)-3,4-dimethyldec-1-en-4-ol.
Molecular Properties
| Compound Name | (3R,4R)-3,4-dimethyldec-1-en-4-ol |
| PubChem CID | 170849264 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | (3R,4R)-3,4-dimethyldec-1-en-4-ol |
| SMILES | C=C[C@@H](C)[C@](C)(O)CCCCCC |
| InChI | InChI=1S/C12H24O/c1-5-7-8-9-10-12(4,13)11(3)6-2/h6,11,13H,2,5,7-10H2,1,3-4H3/t11-,12-/m1/s1 |
| InChIKey | AWCUIMMQNFZKDC-VXGBXAGGSA-N |
| XLogP | 3.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R,4R)-3,4-dimethyldec-1-en-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4R)-3,4-dimethyldec-1-en-4-ol?
The IUPAC name of (3R,4R)-3,4-dimethyldec-1-en-4-ol (CID 170849264) is (3R,4R)-3,4-dimethyldec-1-en-4-ol.
What is the SMILES notation for (3R,4R)-3,4-dimethyldec-1-en-4-ol?
The canonical SMILES for (3R,4R)-3,4-dimethyldec-1-en-4-ol is C=C[C@@H](C)[C@](C)(O)CCCCCC.
What is the InChIKey of (3R,4R)-3,4-dimethyldec-1-en-4-ol?
The InChIKey is AWCUIMMQNFZKDC-VXGBXAGGSA-N. The full InChI is InChI=1S/C12H24O/c1-5-7-8-9-10-12(4,13)11(3)6-2/h6,11,13H,2,5,7-10H2,1,3-4H3/t11-,12-/m1/s1.
What are the key properties of (3R,4R)-3,4-dimethyldec-1-en-4-ol?
(3R,4R)-3,4-dimethyldec-1-en-4-ol has a molecular weight of 184.32 g/mol, XLogP of 3.53, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R)-3,4-dimethyldec-1-en-4-ol is sourced from PubChem (CID 170849264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).