About 3-methylbut-3-enyl 2-methylpentanoate
3-methylbut-3-enyl 2-methylpentanoate (PubChem CID 170849350) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is 3-methylbut-3-enyl 2-methylpentanoate.
Molecular Properties
| Compound Name | 3-methylbut-3-enyl 2-methylpentanoate |
| PubChem CID | 170849350 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 3-methylbut-3-enyl 2-methylpentanoate |
| SMILES | C=C(C)CCOC(=O)C(C)CCC |
| InChI | InChI=1S/C11H20O2/c1-5-6-10(4)11(12)13-8-7-9(2)3/h10H,2,5-8H2,1,3-4H3 |
| InChIKey | ZRIDOPCIWRUDAF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbut-3-enyl 2-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbut-3-enyl 2-methylpentanoate?
The IUPAC name of 3-methylbut-3-enyl 2-methylpentanoate (CID 170849350) is 3-methylbut-3-enyl 2-methylpentanoate.
What is the SMILES notation for 3-methylbut-3-enyl 2-methylpentanoate?
The canonical SMILES for 3-methylbut-3-enyl 2-methylpentanoate is C=C(C)CCOC(=O)C(C)CCC.
What is the InChIKey of 3-methylbut-3-enyl 2-methylpentanoate?
The InChIKey is ZRIDOPCIWRUDAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2/c1-5-6-10(4)11(12)13-8-7-9(2)3/h10H,2,5-8H2,1,3-4H3.
What are the key properties of 3-methylbut-3-enyl 2-methylpentanoate?
3-methylbut-3-enyl 2-methylpentanoate has a molecular weight of 184.28 g/mol, XLogP of 2.93, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbut-3-enyl 2-methylpentanoate is sourced from PubChem (CID 170849350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).