About [hexanoyloxy-di(propan-2-yl)silyl] hexanoate
[hexanoyloxy-di(propan-2-yl)silyl] hexanoate (PubChem CID 170849779) has the molecular formula C18H36O4Si
and a molecular weight of 344.57 g/mol. Its IUPAC name is [hexanoyloxy-di(propan-2-yl)silyl] hexanoate.
Molecular Properties
| Compound Name | [hexanoyloxy-di(propan-2-yl)silyl] hexanoate |
| PubChem CID | 170849779 |
| Molecular Formula | C18H36O4Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | [hexanoyloxy-di(propan-2-yl)silyl] hexanoate |
| SMILES | CCCCCC(=O)O[Si](OC(=O)CCCCC)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H36O4Si/c1-7-9-11-13-17(19)21-23(15(3)4,16(5)6)22-18(20)14-12-10-8-2/h15-16H,7-14H2,1-6H3 |
| InChIKey | CITXFSUPQSFCMB-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [hexanoyloxy-di(propan-2-yl)silyl] hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [hexanoyloxy-di(propan-2-yl)silyl] hexanoate?
The IUPAC name of [hexanoyloxy-di(propan-2-yl)silyl] hexanoate (CID 170849779) is [hexanoyloxy-di(propan-2-yl)silyl] hexanoate.
What is the SMILES notation for [hexanoyloxy-di(propan-2-yl)silyl] hexanoate?
The canonical SMILES for [hexanoyloxy-di(propan-2-yl)silyl] hexanoate is CCCCCC(=O)O[Si](OC(=O)CCCCC)(C(C)C)C(C)C.
What is the InChIKey of [hexanoyloxy-di(propan-2-yl)silyl] hexanoate?
The InChIKey is CITXFSUPQSFCMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O4Si/c1-7-9-11-13-17(19)21-23(15(3)4,16(5)6)22-18(20)14-12-10-8-2/h15-16H,7-14H2,1-6H3.
What are the key properties of [hexanoyloxy-di(propan-2-yl)silyl] hexanoate?
[hexanoyloxy-di(propan-2-yl)silyl] hexanoate has a molecular weight of 344.57 g/mol, XLogP of 5.50, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [hexanoyloxy-di(propan-2-yl)silyl] hexanoate is sourced from PubChem (CID 170849779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).