C22H38O4 — CID 170849877
[(3R,4R)-4-octanoyloxyhexa-1,5-dien-3-yl] octanoate (PubChem CID 170849877) has the molecular formula C22H38O4 and a molecular weight of 366.54 g/mol. Its IUPAC name is [(3R,4R)-4-octanoyloxyhexa-1,5-dien-3-yl] octanoate.
| Compound Name | [(3R,4R)-4-octanoyloxyhexa-1,5-dien-3-yl] octanoate |
|---|---|
| PubChem CID | 170849877 |
| Molecular Formula | C22H38O4 |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | [(3R,4R)-4-octanoyloxyhexa-1,5-dien-3-yl] octanoate |
| SMILES | C=C[C@@H](OC(=O)CCCCCCC)[C@@H](C=C)OC(=O)CCCCCCC |
| InChI | InChI=1S/C22H38O4/c1-5-9-11-13-15-17-21(23)25-19(7-3)20(8-4)26-22(24)18-16-14-12-10-6-2/h7-8,19-20H,3-6,9-18H2,1-2H3/t19-,20-/m1/s1 |
| InChIKey | RFDZXDWMJAAULS-WOJBJXKFSA-N |
| XLogP | 5.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|