C26H5Cl8N2NaO7S — CID 170850297
sodium 4,5,6,7-tetrachloro-3-oxo-2-[6-sulfo-8-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)quinolin-2-yl]inden-1-olate (PubChem CID 170850297) has the molecular formula C26H5Cl8N2NaO7S and a molecular weight of 796.01 g/mol. Its IUPAC name is sodium 4,5,6,7-tetrachloro-3-oxo-2-[6-sulfo-8-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)quinolin-2-yl]inden-1-olate.
| Compound Name | sodium 4,5,6,7-tetrachloro-3-oxo-2-[6-sulfo-8-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)quinolin-2-yl]inden-1-olate |
|---|---|
| PubChem CID | 170850297 |
| Molecular Formula | C26H5Cl8N2NaO7S |
| Molecular Weight | 796.01 g/mol |
| Exact Mass | 791.72 |
| IUPAC Name | sodium 4,5,6,7-tetrachloro-3-oxo-2-[6-sulfo-8-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)quinolin-2-yl]inden-1-olate |
| SMILES | O=C1C(c2ccc3cc(S(=O)(=O)O)cc(N4C(=O)c5c(Cl)c(Cl)c(Cl)c(Cl)c5C4=O)c3n2)=C([O-])c2c(Cl)c(Cl)c(Cl)c(Cl)c21.[Na+] |
| InChI | InChI=1S/C26H6Cl8N2O7S.Na/c27-14-10-11(15(28)19(32)18(14)31)24(38)9(23(10)37)7-2-1-5-3-6(44(41,42)43)4-8(22(5)35-7)36-25(39)12-13(26(36)40)17(30)21(34)20(33)16(12)29;/h1-4,37H,(H,41,42,43);/q;+1/p-1 |
| InChIKey | ZQPISVIUSVOYNA-UHFFFAOYSA-M |
| XLogP | 4.94 |
| TPSA | 144.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.01 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|