C20H16N2O5 — CID 170850509
6,7-diamino-5-(2-hydroxyphenyl)anthracene-1,2,8,9-tetrol (PubChem CID 170850509) has the molecular formula C20H16N2O5 and a molecular weight of 364.36 g/mol. Its IUPAC name is 6,7-diamino-5-(2-hydroxyphenyl)anthracene-1,2,8,9-tetrol.
| Compound Name | 6,7-diamino-5-(2-hydroxyphenyl)anthracene-1,2,8,9-tetrol |
|---|---|
| PubChem CID | 170850509 |
| Molecular Formula | C20H16N2O5 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 6,7-diamino-5-(2-hydroxyphenyl)anthracene-1,2,8,9-tetrol |
| SMILES | Nc1c(N)c(O)c2c(O)c3c(O)c(O)ccc3cc2c1-c1ccccc1O |
| InChI | InChI=1S/C20H16N2O5/c21-16-14(9-3-1-2-4-11(9)23)10-7-8-5-6-12(24)18(25)13(8)19(26)15(10)20(27)17(16)22/h1-7,23-27H,21-22H2 |
| InChIKey | AZZPATLGWXHZJI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 153.19 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|