C14H14N2O4 — CID 170850546
4,8-diamino-9,10-dihydroanthracene-1,2,3,10-tetrol (PubChem CID 170850546) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 4,8-diamino-9,10-dihydroanthracene-1,2,3,10-tetrol.
| Compound Name | 4,8-diamino-9,10-dihydroanthracene-1,2,3,10-tetrol |
|---|---|
| PubChem CID | 170850546 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 4,8-diamino-9,10-dihydroanthracene-1,2,3,10-tetrol |
| SMILES | Nc1cccc2c1Cc1c(O)c(O)c(O)c(N)c1C2O |
| InChI | InChI=1S/C14H14N2O4/c15-8-3-1-2-5-6(8)4-7-9(11(5)17)10(16)13(19)14(20)12(7)18/h1-3,11,17-20H,4,15-16H2 |
| InChIKey | KRMPYZXATXUPHK-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|