About acetic acid;(1R,2S,5R)-5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol
acetic acid;(1R,2S,5R)-5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol (PubChem CID 170851422) has the molecular formula C12H22O3
and a molecular weight of 214.30 g/mol. Its IUPAC name is acetic acid;(1R,2S,5R)-5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol.
Molecular Properties
| Compound Name | acetic acid;(1R,2S,5R)-5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol |
| PubChem CID | 170851422 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | acetic acid;(1R,2S,5R)-5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol |
| SMILES | C=C(C)[C@@H]1CC[C@@H](C)C[C@H]1O.CC(=O)O |
| InChI | InChI=1S/C10H18O.C2H4O2/c1-7(2)9-5-4-8(3)6-10(9)11;1-2(3)4/h8-11H,1,4-6H2,2-3H3;1H3,(H,3,4)/t8-,9+,10-;/m1./s1 |
| InChIKey | KSBCYNFFCICVSC-YMQJAAJZSA-N |
| XLogP | 2.45 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;(1R,2S,5R)-5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;(1R,2S,5R)-5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol?
The IUPAC name of acetic acid;(1R,2S,5R)-5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol (CID 170851422) is acetic acid;(1R,2S,5R)-5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol.
What is the SMILES notation for acetic acid;(1R,2S,5R)-5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol?
The canonical SMILES for acetic acid;(1R,2S,5R)-5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol is C=C(C)[C@@H]1CC[C@@H](C)C[C@H]1O.CC(=O)O.
What is the InChIKey of acetic acid;(1R,2S,5R)-5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol?
The InChIKey is KSBCYNFFCICVSC-YMQJAAJZSA-N. The full InChI is InChI=1S/C10H18O.C2H4O2/c1-7(2)9-5-4-8(3)6-10(9)11;1-2(3)4/h8-11H,1,4-6H2,2-3H3;1H3,(H,3,4)/t8-,9+,10-;/m1./s1.
What are the key properties of acetic acid;(1R,2S,5R)-5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol?
acetic acid;(1R,2S,5R)-5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol has a molecular weight of 214.30 g/mol, XLogP of 2.45, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;(1R,2S,5R)-5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol is sourced from PubChem (CID 170851422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).