About dec-1-enyl-(2-dec-1-enylphenyl)-trioxido-λ5-phosphane
dec-1-enyl-(2-dec-1-enylphenyl)-trioxido-λ5-phosphane (PubChem CID 170851647) has the molecular formula C26H42O3P-3
and a molecular weight of 433.59 g/mol. Its IUPAC name is dec-1-enyl-(2-dec-1-enylphenyl)-trioxido-λ5-phosphane.
Molecular Properties
| Compound Name | dec-1-enyl-(2-dec-1-enylphenyl)-trioxido-λ5-phosphane |
| PubChem CID | 170851647 |
| Molecular Formula | C26H42O3P-3 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.29 |
| IUPAC Name | dec-1-enyl-(2-dec-1-enylphenyl)-trioxido-λ5-phosphane |
| SMILES | CCCCCCCCC=Cc1ccccc1P([O-])([O-])([O-])C=CCCCCCCCC |
| InChI | InChI=1S/C26H42O3P/c1-3-5-7-9-11-13-15-17-21-25-22-18-19-23-26(25)30(27,28,29)24-20-16-14-12-10-8-6-4-2/h17-24H,3-16H2,1-2H3/q-3 |
| InChIKey | AICOSEMVSGWCEQ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 69.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dec-1-enyl-(2-dec-1-enylphenyl)-trioxido-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dec-1-enyl-(2-dec-1-enylphenyl)-trioxido-λ5-phosphane?
The IUPAC name of dec-1-enyl-(2-dec-1-enylphenyl)-trioxido-λ5-phosphane (CID 170851647) is dec-1-enyl-(2-dec-1-enylphenyl)-trioxido-λ5-phosphane.
What is the SMILES notation for dec-1-enyl-(2-dec-1-enylphenyl)-trioxido-λ5-phosphane?
The canonical SMILES for dec-1-enyl-(2-dec-1-enylphenyl)-trioxido-λ5-phosphane is CCCCCCCCC=Cc1ccccc1P([O-])([O-])([O-])C=CCCCCCCCC.
What is the InChIKey of dec-1-enyl-(2-dec-1-enylphenyl)-trioxido-λ5-phosphane?
The InChIKey is AICOSEMVSGWCEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H42O3P/c1-3-5-7-9-11-13-15-17-21-25-22-18-19-23-26(25)30(27,28,29)24-20-16-14-12-10-8-6-4-2/h17-24H,3-16H2,1-2H3/q-3.
What are the key properties of dec-1-enyl-(2-dec-1-enylphenyl)-trioxido-λ5-phosphane?
dec-1-enyl-(2-dec-1-enylphenyl)-trioxido-λ5-phosphane has a molecular weight of 433.59 g/mol, XLogP of 5.72, 17 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dec-1-enyl-(2-dec-1-enylphenyl)-trioxido-λ5-phosphane is sourced from PubChem (CID 170851647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).