About furan-2,5-dione;3-methylbutane-1,3-diol
furan-2,5-dione;3-methylbutane-1,3-diol (PubChem CID 170851722) has the molecular formula C9H14O5
and a molecular weight of 202.21 g/mol. Its IUPAC name is furan-2,5-dione;3-methylbutane-1,3-diol.
Molecular Properties
| Compound Name | furan-2,5-dione;3-methylbutane-1,3-diol |
| PubChem CID | 170851722 |
| Molecular Formula | C9H14O5 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | furan-2,5-dione;3-methylbutane-1,3-diol |
| SMILES | CC(C)(O)CCO.O=C1C=CC(=O)O1 |
| InChI | InChI=1S/C5H12O2.C4H2O3/c1-5(2,7)3-4-6;5-3-1-2-4(6)7-3/h6-7H,3-4H2,1-2H3;1-2H |
| InChIKey | LJUGLAVEFUFEEV-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze furan-2,5-dione;3-methylbutane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-2,5-dione;3-methylbutane-1,3-diol?
The IUPAC name of furan-2,5-dione;3-methylbutane-1,3-diol (CID 170851722) is furan-2,5-dione;3-methylbutane-1,3-diol.
What is the SMILES notation for furan-2,5-dione;3-methylbutane-1,3-diol?
The canonical SMILES for furan-2,5-dione;3-methylbutane-1,3-diol is CC(C)(O)CCO.O=C1C=CC(=O)O1.
What is the InChIKey of furan-2,5-dione;3-methylbutane-1,3-diol?
The InChIKey is LJUGLAVEFUFEEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O2.C4H2O3/c1-5(2,7)3-4-6;5-3-1-2-4(6)7-3/h6-7H,3-4H2,1-2H3;1-2H.
What are the key properties of furan-2,5-dione;3-methylbutane-1,3-diol?
furan-2,5-dione;3-methylbutane-1,3-diol has a molecular weight of 202.21 g/mol, XLogP of -0.23, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2,5-dione;3-methylbutane-1,3-diol is sourced from PubChem (CID 170851722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).