About N'-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethyl]ethane-1,2-diamine;prop-2-enamide
N'-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethyl]ethane-1,2-diamine;prop-2-enamide (PubChem CID 170851960) has the molecular formula C13H33N7O
and a molecular weight of 303.46 g/mol. Its IUPAC name is N'-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethyl]ethane-1,2-diamine;prop-2-enamide.
Molecular Properties
| Compound Name | N'-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethyl]ethane-1,2-diamine;prop-2-enamide |
| PubChem CID | 170851960 |
| Molecular Formula | C13H33N7O |
| Molecular Weight | 303.46 g/mol |
| Exact Mass | 303.27 |
| IUPAC Name | N'-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethyl]ethane-1,2-diamine;prop-2-enamide |
| SMILES | C=CC(N)=O.NCCNCCNCCNCCNCCN |
| InChI | InChI=1S/C10H28N6.C3H5NO/c11-1-3-13-5-7-15-9-10-16-8-6-14-4-2-12;1-2-3(4)5/h13-16H,1-12H2;2H,1H2,(H2,4,5) |
| InChIKey | MKEQNITZOUHKPJ-UHFFFAOYSA-N |
| XLogP | -3.08 |
| TPSA | 143.25 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 303.46 |
| LogP ≤ 5 | -3.08 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethyl]ethane-1,2-diamine;prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethyl]ethane-1,2-diamine;prop-2-enamide?
The IUPAC name of N'-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethyl]ethane-1,2-diamine;prop-2-enamide (CID 170851960) is N'-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethyl]ethane-1,2-diamine;prop-2-enamide.
What is the SMILES notation for N'-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethyl]ethane-1,2-diamine;prop-2-enamide?
The canonical SMILES for N'-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethyl]ethane-1,2-diamine;prop-2-enamide is C=CC(N)=O.NCCNCCNCCNCCNCCN.
What is the InChIKey of N'-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethyl]ethane-1,2-diamine;prop-2-enamide?
The InChIKey is MKEQNITZOUHKPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H28N6.C3H5NO/c11-1-3-13-5-7-15-9-10-16-8-6-14-4-2-12;1-2-3(4)5/h13-16H,1-12H2;2H,1H2,(H2,4,5).
What are the key properties of N'-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethyl]ethane-1,2-diamine;prop-2-enamide?
N'-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethyl]ethane-1,2-diamine;prop-2-enamide has a molecular weight of 303.46 g/mol, XLogP of -3.08, 14 rotatable bonds, 7 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethyl]ethane-1,2-diamine;prop-2-enamide is sourced from PubChem (CID 170851960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).