C22H30O2 — CID 170852070
bicyclo[2.2.1]hept-2-ene;methyl 4-methyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate (PubChem CID 170852070) has the molecular formula C22H30O2 and a molecular weight of 326.48 g/mol. Its IUPAC name is bicyclo[2.2.1]hept-2-ene;methyl 4-methyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate.
| Compound Name | bicyclo[2.2.1]hept-2-ene;methyl 4-methyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
|---|---|
| PubChem CID | 170852070 |
| Molecular Formula | C22H30O2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | bicyclo[2.2.1]hept-2-ene;methyl 4-methyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
| SMILES | C1=CC2CCC1C2.COC(=O)C1(C)CC2CC1C1C3C=CC(C3)C21 |
| InChI | InChI=1S/C15H20O2.C7H10/c1-15(14(16)17-2)7-10-6-11(15)13-9-4-3-8(5-9)12(10)13;1-2-7-4-3-6(1)5-7/h3-4,8-13H,5-7H2,1-2H3;1-2,6-7H,3-5H2 |
| InChIKey | ICLYVTVMUISLKS-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|