C22H20N2O6 — CID 170852092
4-[(4-aminophenyl)methyl]aniline;benzene-1,2,4-tricarboxylic acid (PubChem CID 170852092) has the molecular formula C22H20N2O6 and a molecular weight of 408.41 g/mol. Its IUPAC name is 4-[(4-aminophenyl)methyl]aniline;benzene-1,2,4-tricarboxylic acid.
| Compound Name | 4-[(4-aminophenyl)methyl]aniline;benzene-1,2,4-tricarboxylic acid |
|---|---|
| PubChem CID | 170852092 |
| Molecular Formula | C22H20N2O6 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 4-[(4-aminophenyl)methyl]aniline;benzene-1,2,4-tricarboxylic acid |
| SMILES | Nc1ccc(Cc2ccc(N)cc2)cc1.O=C(O)c1ccc(C(=O)O)c(C(=O)O)c1 |
| InChI | InChI=1S/C13H14N2.C9H6O6/c14-12-5-1-10(2-6-12)9-11-3-7-13(15)8-4-11;10-7(11)4-1-2-5(8(12)13)6(3-4)9(14)15/h1-8H,9,14-15H2;1-3H,(H,10,11)(H,12,13)(H,14,15) |
| InChIKey | TZAMQGSXWTYELG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 163.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|